CAS 1556884-64-0 appears in our catalog under these names: 2–(2,6–dichlorophenyl)–2,2–difluoroacetic acid, 2-(2,6-Dichlorophenyl)-2,2-difluoroacetic acid. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g.
2-(2,6-dichlorophenyl)-2,2-difluoroacetic acid (CAS 1556884-64-0) is a chemical compound with the molecular formula C8H4Cl2F2O2 and a molecular weight of 241.02 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)-2,2-difluoroacetic acid. InChIKey: YREJVPRTNUHBFI-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2F2O2 |
|---|---|
| Molecular weight | 241.02 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)-2,2-difluoroacetic acid |
| InChIKey | YREJVPRTNUHBFI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(C(=O)O)(F)F)Cl |
Computed by PubChem (NCBI)