CAS 56072-00-5 appears in our catalog under these names: 2–(3,4–dichlorophenyl)–2,2–difluoroacetic, 2-(3,4-Dichlorophenyl)-2,2-difluoroacetic acid, 2-(3,4-dichlorophenyl)-2,2-difluoroacetic acid, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 10mg, 1g, 5g.
2-(3,4-dichlorophenyl)-2,2-difluoroacetic acid (CAS 56072-00-5) is a chemical compound with the molecular formula C8H4Cl2F2O2 and a molecular weight of 241.02 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-2,2-difluoroacetic acid. InChIKey: NHZDLBDSYBPCQZ-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2F2O2 |
|---|---|
| Molecular weight | 241.02 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-2,2-difluoroacetic acid |
| InChIKey | NHZDLBDSYBPCQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(=O)O)(F)F)Cl)Cl |
Computed by PubChem (NCBI)