CAS 1248366-67-7 appears in our catalog under these names: 2-(2,5-Dichlorophenyl)-2,2-difluoroacetic acid, 95%, 2-(2,5-Dichlorophenyl)-2,2-difluoroacetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(2,5-dichlorophenyl)-2,2-difluoroacetic acid (CAS 1248366-67-7) is a chemical compound with the molecular formula C8H4Cl2F2O2 and a molecular weight of 241.02 g/mol. IUPAC name: 2-(2,5-dichlorophenyl)-2,2-difluoroacetic acid. InChIKey: QEOYDNJHVIODTI-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2F2O2 |
|---|---|
| Molecular weight | 241.02 g/mol |
| IUPAC name | 2-(2,5-dichlorophenyl)-2,2-difluoroacetic acid |
| InChIKey | QEOYDNJHVIODTI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(C(=O)O)(F)F)Cl |
Computed by PubChem (NCBI)