CAS 1260762-88-6 appears in our catalog under these names: (3,5-Dichlorophenyl)difluoroacetic acid, 98%, 2-(3,5-Dichlorophenyl)-2,2-difluoroacetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
2-(3,5-dichlorophenyl)-2,2-difluoroacetic acid (CAS 1260762-88-6) is a chemical compound with the molecular formula C8H4Cl2F2O2 and a molecular weight of 241.02 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)-2,2-difluoroacetic acid. InChIKey: MUAXKRKJDNBVTD-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2F2O2 |
|---|---|
| Molecular weight | 241.02 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)-2,2-difluoroacetic acid |
| InChIKey | MUAXKRKJDNBVTD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)