Products 1260762-88-6

CAS 1260762-88-6 appears in our catalog under these names: (3,5-Dichlorophenyl)difluoroacetic acid, 98%, 2-(3,5-Dichlorophenyl)-2,2-difluoroacetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.

Structural formula: {0} (CAS {1})

2-(3,5-dichlorophenyl)-2,2-difluoroacetic acid (CAS 1260762-88-6) is a chemical compound with the molecular formula C8H4Cl2F2O2 and a molecular weight of 241.02 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)-2,2-difluoroacetic acid. InChIKey: MUAXKRKJDNBVTD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4Cl2F2O2
Molecular weight241.02 g/mol
IUPAC name2-(3,5-dichlorophenyl)-2,2-difluoroacetic acid
InChIKeyMUAXKRKJDNBVTD-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1Cl)Cl)C(C(=O)O)(F)F

Computed by PubChem (NCBI)