CAS 1552586-81-8 is the registry number for 2–(2,4–dichlorophenyl)–2,2–difluoroacetic acid. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
2-(2,4-dichlorophenyl)-2,2-difluoroacetic acid (CAS 1552586-81-8) is a chemical compound with the molecular formula C8H4Cl2F2O2 and a molecular weight of 241.02 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-2,2-difluoroacetic acid. InChIKey: CDXMEVWDQNSWQG-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2F2O2 |
|---|---|
| Molecular weight | 241.02 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-2,2-difluoroacetic acid |
| InChIKey | CDXMEVWDQNSWQG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)