CAS 1153285-63-2 appears in our catalog under these names: Ethyl 2,4,6-trimethyl-3-nitrobenzoate, 95%, Ethyl 2,4,6-trimethyl-3-nitrobenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Ethyl 2,4,6-trimethyl-3-nitrobenzoate (CAS 1153285-63-2) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: ethyl 2,4,6-trimethyl-3-nitrobenzoate. InChIKey: OUPCDOPMMAJMMR-UHFFFAOYSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | ethyl 2,4,6-trimethyl-3-nitrobenzoate |
| InChIKey | OUPCDOPMMAJMMR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(C=C1C)C)[N+](=O)[O-])C |
Computed by PubChem (NCBI)