Products 1153491-02-1
CAS 1153491-02-1 appears in our catalog under these names: 1-(2-Fluorophenyl)-1H-1,2,3-triazole-5-carboxylic acid, 97%, 1-(2-Fluorophenyl)-1H-1,2,3-triazole-5-carboxylic acid, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(2-fluorophenyl)triazole-4-carboxylic acid (CAS 1153491-02-1) is a chemical compound with the molecular formula C9H6FN3O2 and a molecular weight of 207.16 g/mol. IUPAC name: 3-(2-fluorophenyl)triazole-4-carboxylic acid. InChIKey: AESCJXDKJLSCCK-UHFFFAOYSA-N.
| Molecular formula | C9H6FN3O2 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 3-(2-fluorophenyl)triazole-4-carboxylic acid |
| InChIKey | AESCJXDKJLSCCK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C(=CN=N2)C(=O)O)F |
Computed by PubChem (NCBI)