CAS 1153776-34-1 appears in our catalog under these names: 2-(4-Bromophenoxy)-2,2-difluoroacetic acid, 95%, 2-(4-Bromophenoxy)-2,2-difluoroacetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg.
2-(4-bromophenoxy)-2,2-difluoroacetic acid (CAS 1153776-34-1) is a chemical compound with the molecular formula C8H5BrF2O3 and a molecular weight of 267.02 g/mol. IUPAC name: 2-(4-bromophenoxy)-2,2-difluoroacetic acid. InChIKey: YGWFXCNFJPSDPX-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O3 |
|---|---|
| Molecular weight | 267.02 g/mol |
| IUPAC name | 2-(4-bromophenoxy)-2,2-difluoroacetic acid |
| InChIKey | YGWFXCNFJPSDPX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC(C(=O)O)(F)F)Br |
Computed by PubChem (NCBI)