CAS 1249235-55-9 appears in our catalog under these names: 3-Bromo-2-(difluoromethoxy)benzoic acid, 95%, 3-Bromo-2-(difluoromethoxy)benzoic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 500mg.
3-bromo-2-(difluoromethoxy)benzoic acid (CAS 1249235-55-9) is a chemical compound with the molecular formula C8H5BrF2O3 and a molecular weight of 267.02 g/mol. IUPAC name: 3-bromo-2-(difluoromethoxy)benzoic acid. InChIKey: KBULGJLMGDNXAE-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O3 |
|---|---|
| Molecular weight | 267.02 g/mol |
| IUPAC name | 3-bromo-2-(difluoromethoxy)benzoic acid |
| InChIKey | KBULGJLMGDNXAE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)OC(F)F)C(=O)O |
Computed by PubChem (NCBI)