Products 1934409-25-2
CAS 1934409-25-2 is the registry number for 2-Bromo-3-(difluoromethoxy)benzoic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2-bromo-3-(difluoromethoxy)benzoic acid (CAS 1934409-25-2) is a chemical compound with the molecular formula C8H5BrF2O3 and a molecular weight of 267.02 g/mol. IUPAC name: 2-bromo-3-(difluoromethoxy)benzoic acid. InChIKey: HNVSZIQEHSLIHA-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O3 |
|---|---|
| Molecular weight | 267.02 g/mol |
| IUPAC name | 2-bromo-3-(difluoromethoxy)benzoic acid |
| InChIKey | HNVSZIQEHSLIHA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)OC(F)F)Br)C(=O)O |
Computed by PubChem (NCBI)