CAS 438221-79-5 appears in our catalog under these names: 5-Bromo-2-(difluoromethoxy)benzoic acid, 5-Bromo-2-(difluoromethoxy)benzoic acid, 95+%, 5-Bromo-2-difluoromethoxy-benzoic acid, 97%. Offered by: Biosynth, AmBeed, Fluorochem. Available pack sizes: 2,5g, 100mg, 1g, 5g.
5-bromo-2-(difluoromethoxy)benzoic acid (CAS 438221-79-5) is a chemical compound with the molecular formula C8H5BrF2O3 and a molecular weight of 267.02 g/mol. IUPAC name: 5-bromo-2-(difluoromethoxy)benzoic acid. InChIKey: OWVVZPMQHORKEA-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O3 |
|---|---|
| Molecular weight | 267.02 g/mol |
| IUPAC name | 5-bromo-2-(difluoromethoxy)benzoic acid |
| InChIKey | OWVVZPMQHORKEA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)O)OC(F)F |
Computed by PubChem (NCBI)