Products 1897123-68-0

CAS 1897123-68-0 is the registry number for 2-(4-Bromo-2,3-difluorophenyl)-2-hydroxyacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(4-bromo-2,3-difluorophenyl)-2-hydroxyacetic acid (CAS 1897123-68-0) is a chemical compound with the molecular formula C8H5BrF2O3 and a molecular weight of 267.02 g/mol. IUPAC name: 2-(4-bromo-2,3-difluorophenyl)-2-hydroxyacetic acid. InChIKey: DKFUXMLNQKFFBD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5BrF2O3
Molecular weight267.02 g/mol
IUPAC name2-(4-bromo-2,3-difluorophenyl)-2-hydroxyacetic acid
InChIKeyDKFUXMLNQKFFBD-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1C(C(=O)O)O)F)F)Br

Computed by PubChem (NCBI)