Products 2807440-30-6
CAS 2807440-30-6 is the registry number for 4-Bromo-2,6-difluoro-3-methoxybenzoic acid, ≥96.5%, ≥96.5%. Offered by: Chemat. Available pack sizes: 1g.
4-bromo-2,6-difluoro-3-methoxybenzoic acid (CAS 2807440-30-6) is a chemical compound with the molecular formula C8H5BrF2O3 and a molecular weight of 267.02 g/mol. IUPAC name: 4-bromo-2,6-difluoro-3-methoxybenzoic acid. InChIKey: OHILSYDGMOUCFE-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O3 |
|---|---|
| Molecular weight | 267.02 g/mol |
| IUPAC name | 4-bromo-2,6-difluoro-3-methoxybenzoic acid |
| InChIKey | OHILSYDGMOUCFE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1F)C(=O)O)F)Br |
Computed by PubChem (NCBI)