Products 2921834-10-6
CAS 2921834-10-6 is the registry number for 5-bromo-4-(difluoromethoxy)benzo[d][1,3]dioxole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-4-(difluoromethoxy)-1,3-benzodioxole (CAS 2921834-10-6) is a chemical compound with the molecular formula C8H5BrF2O3 and a molecular weight of 267.02 g/mol. IUPAC name: 5-bromo-4-(difluoromethoxy)-1,3-benzodioxole. InChIKey: DYYZLCHLRYCIDH-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O3 |
|---|---|
| Molecular weight | 267.02 g/mol |
| IUPAC name | 5-bromo-4-(difluoromethoxy)-1,3-benzodioxole |
| InChIKey | DYYZLCHLRYCIDH-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=C(C=C2)Br)OC(F)F |
Computed by PubChem (NCBI)