CAS 1154235-68-3 appears in our catalog under these names: 5-Methanesulfonyl-2-(2-methoxyethoxy)aniline, 95%, 5–Methanesulfonyl–2–(2–methoxyethoxy)aniline, 5-Methanesulfonyl-2-(2-methoxyethoxy)aniline. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(2-methoxyethoxy)-5-methylsulfonylaniline (CAS 1154235-68-3) is a chemical compound with the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. IUPAC name: 2-(2-methoxyethoxy)-5-methylsulfonylaniline. InChIKey: CBLCLRLPPKIUFH-UHFFFAOYSA-N.
| Molecular formula | C10H15NO4S |
|---|---|
| Molecular weight | 245.30 g/mol |
| IUPAC name | 2-(2-methoxyethoxy)-5-methylsulfonylaniline |
| InChIKey | CBLCLRLPPKIUFH-UHFFFAOYSA-N |
| SMILES | COCCOC1=C(C=C(C=C1)S(=O)(=O)C)N |
Computed by PubChem (NCBI)