Products 1154567-07-3
CAS 1154567-07-3 is the registry number for 1-(4-Chlorophenyl)-3-(furan-2-yl)-1H-pyrazol-5-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(4-chlorophenyl)-3-(furan-2-yl)pyrazol-5-amine (CAS 1154567-07-3) is a chemical compound with the molecular formula C13H10ClN3O and a molecular weight of 259.69 g/mol. IUPAC name: 1-(4-chlorophenyl)-3-(furan-2-yl)pyrazol-5-amine. InChIKey: WCCFYIUYTAJWFD-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3O |
|---|---|
| Molecular weight | 259.69 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3-(furan-2-yl)pyrazol-5-amine |
| InChIKey | WCCFYIUYTAJWFD-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NN(C(=C2)N)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)