CAS 1155064-95-1 appears in our catalog under these names: 1-((3-Methyl-1,2,4-oxadiazol-5-yl)methyl)-1H-pyrazole-4-carboxylic acid, 95%, 1-((3-Methyl-1,2,4-oxadiazol-5-yl)methyl)-1H-pyrazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyrazole-4-carboxylic acid (CAS 1155064-95-1) is a chemical compound with the molecular formula C8H8N4O3 and a molecular weight of 208.17 g/mol. IUPAC name: 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyrazole-4-carboxylic acid. InChIKey: RUWBQGPANCGRDD-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O3 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyrazole-4-carboxylic acid |
| InChIKey | RUWBQGPANCGRDD-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)CN2C=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)