Products 760179-80-4
CAS 760179-80-4 appears in our catalog under these names: 2-Nitrobenzaldehyde Semicarbazone-13C,15N2, 2-Nitrobenzaldehyde semicarbazone 13C,15N2, 2-Nitrobenzaldehyde semicarbazone-13C,15N2, 98.02%. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 1mg, 25mg, 10mg, 5mg, 50mg, 5 mg, 1 mg.
[(E)-(2-nitrophenyl)methylideneamino](13C)urea (CAS 760179-80-4) is a chemical compound with the molecular formula C8H8N4O3 and a molecular weight of 211.15 g/mol. IUPAC name: [(E)-(2-nitrophenyl)methylideneamino](13C)urea. InChIKey: OEOKLBSECDAYSM-MBGFRBFQSA-N.
| Molecular formula | C8H8N4O3 |
|---|---|
| Molecular weight | 211.15 g/mol |
| IUPAC name | [(E)-(2-nitrophenyl)methylideneamino](13C)urea |
| InChIKey | OEOKLBSECDAYSM-MBGFRBFQSA-N |
| SMILES | C1=CC=C(C(=C1)/C=N/[15NH][13C](=O)[15NH2])[N+](=O)[O-] |
Computed by PubChem (NCBI)