CAS 34397-00-7 appears in our catalog under these names: 3-(6-Oxo-3H-purin-9(6H)-yl)propanoic acid, 97%, 7N-(1-(2-Carboxy)ethyl)allopurinol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg.
3-(6-oxo-1H-purin-9-yl)propanoic acid (CAS 34397-00-7) is a chemical compound with the molecular formula C8H8N4O3 and a molecular weight of 208.17 g/mol. IUPAC name: 3-(6-oxo-1H-purin-9-yl)propanoic acid. InChIKey: MKWZIJJOHBDENE-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O3 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 3-(6-oxo-1H-purin-9-yl)propanoic acid |
| InChIKey | MKWZIJJOHBDENE-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(C(=O)N1)N=CN2CCC(=O)O |
Computed by PubChem (NCBI)