CAS 99951-00-5 appears in our catalog under these names: 2-(7-Hydroxy-5-methyl-(1,2,4)triazolo(1,5-a)pyrimidin-2-yl)acetic acid, 97%, (7-Hydroxy-5-methyl-(1,2,4)triazolo-(1,5-a)pyrimidin-2-yl)-acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-(5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetic acid (CAS 99951-00-5) is a chemical compound with the molecular formula C8H8N4O3 and a molecular weight of 208.17 g/mol. IUPAC name: 2-(5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetic acid. InChIKey: CGAFFDYYFREHLJ-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O3 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 2-(5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetic acid |
| InChIKey | CGAFFDYYFREHLJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C(=N1)N=C(N2)CC(=O)O |
Computed by PubChem (NCBI)