CAS 16004-43-6 appears in our catalog under these names: 2-Nitrobenzaldehyde Semicarbazone, >95% (HPLC), 2-NP-SCA, 2-Nitrobenzaldehyde Semicarbazone, 2-(2-Nitrobenzylidene)hydrazinecarboxamide, 2-Nitrobenzaldehyde semicarbazone, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, TargetMol, Chemat, HPC Standards. Available pack sizes: 2,5g, 250mg, 10mg, 1mg, 5mg, 25mg, 50mg, 100mg.
[(E)-(2-nitrophenyl)methylideneamino]urea (CAS 16004-43-6) is a chemical compound with the molecular formula C8H8N4O3 and a molecular weight of 208.17 g/mol. IUPAC name: [(E)-(2-nitrophenyl)methylideneamino]urea. InChIKey: OEOKLBSECDAYSM-BJMVGYQFSA-N.
| Molecular formula | C8H8N4O3 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | [(E)-(2-nitrophenyl)methylideneamino]urea |
| InChIKey | OEOKLBSECDAYSM-BJMVGYQFSA-N |
| SMILES | C1=CC=C(C(=C1)/C=N/NC(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)