CAS 4921-54-4 appears in our catalog under these names: 3,7-Dimethyl-2,6-dioxo-2,3,6,7-tetrahydro-1h-purine-8-carbaldehyde, 95%, 3,7-Dimethyl-2,6-dioxo-2,3,6,7-tetrahydro-1H-purine-8-carbaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g.
3,7-dimethyl-2,6-dioxopurine-8-carbaldehyde (CAS 4921-54-4) is a chemical compound with the molecular formula C8H8N4O3 and a molecular weight of 208.17 g/mol. IUPAC name: 3,7-dimethyl-2,6-dioxopurine-8-carbaldehyde. InChIKey: CPYUSVWJDYXCEM-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O3 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 3,7-dimethyl-2,6-dioxopurine-8-carbaldehyde |
| InChIKey | CPYUSVWJDYXCEM-UHFFFAOYSA-N |
| SMILES | CN1C(=NC2=C1C(=O)NC(=O)N2C)C=O |
Computed by PubChem (NCBI)