CAS 89977-75-3 is the registry number for 5,7-Dimethyl-3-nitropyrazolo[1,5-a]pyrimidin-2(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dimethyl-3-nitro-1H-pyrazolo[1,5-a]pyrimidin-2-one (CAS 89977-75-3) is a chemical compound with the molecular formula C8H8N4O3 and a molecular weight of 208.17 g/mol. IUPAC name: 5,7-dimethyl-3-nitro-1H-pyrazolo[1,5-a]pyrimidin-2-one. InChIKey: XMTWAYDEJOPLRC-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O3 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 5,7-dimethyl-3-nitro-1H-pyrazolo[1,5-a]pyrimidin-2-one |
| InChIKey | XMTWAYDEJOPLRC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C(C(=O)NN12)[N+](=O)[O-])C |
Computed by PubChem (NCBI)