Products 1155533-58-6
CAS 1155533-58-6 appears in our catalog under these names: N-(2,4-Difluorophenyl)-2-hydroxyacetamide, 95%, N-(2,4-Difluorophenyl)-2-hydroxyacetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
N-(2,4-difluorophenyl)-2-hydroxyacetamide (CAS 1155533-58-6) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: N-(2,4-difluorophenyl)-2-hydroxyacetamide. InChIKey: SJJWOXOLPJSKMV-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | N-(2,4-difluorophenyl)-2-hydroxyacetamide |
| InChIKey | SJJWOXOLPJSKMV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)NC(=O)CO |
Computed by PubChem (NCBI)