Products 1155575-89-5
CAS 1155575-89-5 is the registry number for 1-(3-Cyanophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid, 98%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3-cyanophenyl)-5-methylpyrazole-4-carboxylic acid (CAS 1155575-89-5) is a chemical compound with the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. IUPAC name: 1-(3-cyanophenyl)-5-methylpyrazole-4-carboxylic acid. InChIKey: HKSUROFDHCFZGK-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O2 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 1-(3-cyanophenyl)-5-methylpyrazole-4-carboxylic acid |
| InChIKey | HKSUROFDHCFZGK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C2=CC=CC(=C2)C#N)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1-(3-Cyanophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid, 1-(3-cyanophenyl)-5-methylpyrazole-4-carboxylic acid, 1H-Pyrazole-4-carboxylic acid, 1-(3-cyanophenyl)-5-methyl-, starbld0013422, 1-(3-cyanophenyl)-5-methyl-pyrazole-4-carboxylic acid, 1-(3-cyanophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid - [C93027]