CAS 115799-99-0 appears in our catalog under these names: 2,4-dichloro-6-methyl-pyrido[2,3-d]pyrimidine, 95%, 2,4-Dichloro-6-methylpyrido[2,3-d]pyrimidine, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg.
2,4-dichloro-6-methylpyrido[2,3-d]pyrimidine (CAS 115799-99-0) is a chemical compound with the molecular formula C8H5Cl2N3 and a molecular weight of 214.05 g/mol. IUPAC name: 2,4-dichloro-6-methylpyrido[2,3-d]pyrimidine. InChIKey: SSXPCQOZMQMHNJ-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3 |
|---|---|
| Molecular weight | 214.05 g/mol |
| IUPAC name | 2,4-dichloro-6-methylpyrido[2,3-d]pyrimidine |
| InChIKey | SSXPCQOZMQMHNJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N=C1)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)