Products 870717-94-5
CAS 870717-94-5 appears in our catalog under these names: 2-(2-Chloro-6-fluorophenyl)ethylamine hydrochloride, 95%, 2-(2-Chloro-6-fluorophenyl)ethanamine hydrochloride (1:1). Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg, 500mg.
2-(2-chloro-6-fluorophenyl)ethanamine;hydrochloride (CAS 870717-94-5) is a chemical compound with the molecular formula C8H10Cl2FN and a molecular weight of 210.07 g/mol. IUPAC name: 2-(2-chloro-6-fluorophenyl)ethanamine;hydrochloride. InChIKey: OYMFFGSDALCZHK-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2FN |
|---|---|
| Molecular weight | 210.07 g/mol |
| IUPAC name | 2-(2-chloro-6-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | OYMFFGSDALCZHK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CCN)F.Cl |
Computed by PubChem (NCBI)