Products 1158452-11-9
CAS 1158452-11-9 appears in our catalog under these names: N-(4-Nitrobenzyl)ethanamine hydrochloride, 98%, N-(4-Nitrobenzyl)ethanaMine HCl, 98%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 10g, 1g, 25g, 5g, 250mg.
N-[(4-nitrophenyl)methyl]ethanamine;hydrochloride (CAS 1158452-11-9) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: N-[(4-nitrophenyl)methyl]ethanamine;hydrochloride. InChIKey: AOFIPYOEICEMFY-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | N-[(4-nitrophenyl)methyl]ethanamine;hydrochloride |
| InChIKey | AOFIPYOEICEMFY-UHFFFAOYSA-N |
| SMILES | CCNCC1=CC=C(C=C1)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)