CAS 116002-29-0 is the registry number for Regadenoson Impurity 28. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 1g, 0,5g.
(2R,3R,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol (CAS 116002-29-0) is a chemical compound with the molecular formula C10H14N6O3 and a molecular weight of 266.26 g/mol. IUPAC name: (2R,3R,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol. InChIKey: NOLHIMIFXOBLFF-HSUXUTPPSA-N.
| Molecular formula | C10H14N6O3 |
|---|---|
| Molecular weight | 266.26 g/mol |
| IUPAC name | (2R,3R,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | NOLHIMIFXOBLFF-HSUXUTPPSA-N |
| SMILES | C1[C@H]([C@H](O[C@H]1N2C=NC3=C(N=C(N=C32)N)N)CO)O |
Computed by PubChem (NCBI)