CAS 14365-44-7 appears in our catalog under these names: 5'-Amino-5'-deoxyadenosine/ 95.55% (existing batch purity), 5'–Amino–5'–deoxyadenosine, 5'-Amino-5'-deoxyadenosine hydrochloride, 5''-Amino-5''-deoxyadenosine, 98.00%, 5'-Amino-5'-deoxyadenosine 92%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, Ambeed. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1g, 2mg, 1mg, 100mg.
(2R,3S,4R,5R)-2-(aminomethyl)-5-(6-aminopurin-9-yl)oxolane-3,4-diol (CAS 14365-44-7) is a chemical compound with the molecular formula C10H14N6O3 and a molecular weight of 266.26 g/mol. IUPAC name: (2R,3S,4R,5R)-2-(aminomethyl)-5-(6-aminopurin-9-yl)oxolane-3,4-diol. InChIKey: GVSGUDGNTHCZHI-KQYNXXCUSA-N.
| Molecular formula | C10H14N6O3 |
|---|---|
| Molecular weight | 266.26 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2-(aminomethyl)-5-(6-aminopurin-9-yl)oxolane-3,4-diol |
| InChIKey | GVSGUDGNTHCZHI-KQYNXXCUSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CN)O)O)N |
Computed by PubChem (NCBI)