CAS 69427-80-1 is the registry number for Adenosine Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S,4S,5R)-4-amino-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol (CAS 69427-80-1) is a chemical compound with the molecular formula C10H14N6O3 and a molecular weight of 266.26 g/mol. IUPAC name: (2R,3S,4S,5R)-4-amino-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol. InChIKey: CQKMBZHLOYVGHW-GQTRHBFLSA-N.
| Molecular formula | C10H14N6O3 |
|---|---|
| Molecular weight | 266.26 g/mol |
| IUPAC name | (2R,3S,4S,5R)-4-amino-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | CQKMBZHLOYVGHW-GQTRHBFLSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@H]([C@@H]([C@H](O3)CO)O)N)N |
Computed by PubChem (NCBI)