CAS 132471-87-5 is the registry number for 3'-O-NH2-2'-dA. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3S,5R)-3-aminooxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methanol (CAS 132471-87-5) is a chemical compound with the molecular formula C10H14N6O3 and a molecular weight of 266.26 g/mol. IUPAC name: [(2R,3S,5R)-3-aminooxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methanol. InChIKey: UNOVJEREIAJHTD-RRKCRQDMSA-N.
| Molecular formula | C10H14N6O3 |
|---|---|
| Molecular weight | 266.26 g/mol |
| IUPAC name | [(2R,3S,5R)-3-aminooxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methanol |
| InChIKey | UNOVJEREIAJHTD-RRKCRQDMSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)CO)ON |
Computed by PubChem (NCBI)