CAS 2197964-95-5 is the registry number for (S)-NSC 121182. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R,4S,5R)-4-amino-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol (CAS 2197964-95-5) is a chemical compound with the molecular formula C10H14N6O3 and a molecular weight of 266.26 g/mol. IUPAC name: (2R,3R,4S,5R)-4-amino-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol. InChIKey: CQKMBZHLOYVGHW-IBLRLFODSA-N.
| Molecular formula | C10H14N6O3 |
|---|---|
| Molecular weight | 266.26 g/mol |
| IUPAC name | (2R,3R,4S,5R)-4-amino-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | CQKMBZHLOYVGHW-IBLRLFODSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@H]([C@H]([C@H](O3)CO)O)N)N |
Computed by PubChem (NCBI)