CAS 4546-70-7 appears in our catalog under these names: 2,6-Diaminopurine-2'-deoxyriboside, 95%, Cladribine EP Impurity A, 2,6-Diaminopurine-2’-deoxyriboside, >95% (HPLC), 2–Amino–2'–deoxyadenosine, 2-Amino-2'-deoxyadenosine, 99% . Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 25g, 5g, 1g, on request, 250mg, 25mg, 100mg, 50g.
(2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol (CAS 4546-70-7) is a chemical compound with the molecular formula C10H14N6O3 and a molecular weight of 266.26 g/mol. IUPAC name: (2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol. InChIKey: NOLHIMIFXOBLFF-KVQBGUIXSA-N.
| Molecular formula | C10H14N6O3 |
|---|---|
| Molecular weight | 266.26 g/mol |
| IUPAC name | (2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | NOLHIMIFXOBLFF-KVQBGUIXSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=C(N=C32)N)N)CO)O |
Computed by PubChem (NCBI)