CAS 13389-09-8 is the registry number for 8-Amino-2′-deoxyadenosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3S,5R)-5-(6,8-diaminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol (CAS 13389-09-8) is a chemical compound with the molecular formula C10H14N6O3 and a molecular weight of 266.26 g/mol. IUPAC name: (2R,3S,5R)-5-(6,8-diaminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol. InChIKey: KHQCCEUMCUSZKM-KVQBGUIXSA-N.
| Molecular formula | C10H14N6O3 |
|---|---|
| Molecular weight | 266.26 g/mol |
| IUPAC name | (2R,3S,5R)-5-(6,8-diaminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | KHQCCEUMCUSZKM-KVQBGUIXSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C3=NC=NC(=C3N=C2N)N)CO)O |
Computed by PubChem (NCBI)