Products 1160994-79-5
CAS 1160994-79-5 appears in our catalog under these names: 2,4-Dichloro-5-methylfuro[2,3-d]pyrimidine, 2,4-Dichloro-5-methylfuro[2,3-d]pyrimidine 98%, 2,4-Dichloro-5-methylfuro[2,3-d]pyrimidine, 98%, 98%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,4-dichloro-5-methylfuro[2,3-d]pyrimidine (CAS 1160994-79-5) is a chemical compound with the molecular formula C7H4Cl2N2O and a molecular weight of 203.02 g/mol. IUPAC name: 2,4-dichloro-5-methylfuro[2,3-d]pyrimidine. InChIKey: OCTXLKXOUFKWPY-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2O |
|---|---|
| Molecular weight | 203.02 g/mol |
| IUPAC name | 2,4-dichloro-5-methylfuro[2,3-d]pyrimidine |
| InChIKey | OCTXLKXOUFKWPY-UHFFFAOYSA-N |
| SMILES | CC1=COC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)