CAS 1162674-68-1 appears in our catalog under these names: 2,4-Difluoro-5-formylbenzoic acid, 95%, 2,4-Difluoro-5-formylbenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
2,4-difluoro-5-formylbenzoic acid (CAS 1162674-68-1) is a chemical compound with the molecular formula C8H4F2O3 and a molecular weight of 186.11 g/mol. IUPAC name: 2,4-difluoro-5-formylbenzoic acid. InChIKey: YHYYHMVYTOLOLJ-UHFFFAOYSA-N.
| Molecular formula | C8H4F2O3 |
|---|---|
| Molecular weight | 186.11 g/mol |
| IUPAC name | 2,4-difluoro-5-formylbenzoic acid |
| InChIKey | YHYYHMVYTOLOLJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1C(=O)O)F)F)C=O |
Computed by PubChem (NCBI)