CAS 1890953-67-9 appears in our catalog under these names: 2,5-Difluoro-4-formylbenzoic acid, 95%, 2,5-difluoro-4-formylbenzoic acid, 2,5-Difluoro-4-formylbenzoic acid 95%, 2,5-Difluoro-4-formylbenzoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg, 0,5g, 50mg, 100mg.
2,5-difluoro-4-formylbenzoic acid (CAS 1890953-67-9) is a chemical compound with the molecular formula C8H4F2O3 and a molecular weight of 186.11 g/mol. IUPAC name: 2,5-difluoro-4-formylbenzoic acid. InChIKey: LIBRYAQSVXEDNN-UHFFFAOYSA-N.
| Molecular formula | C8H4F2O3 |
|---|---|
| Molecular weight | 186.11 g/mol |
| IUPAC name | 2,5-difluoro-4-formylbenzoic acid |
| InChIKey | LIBRYAQSVXEDNN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)C(=O)O)F)C=O |
Computed by PubChem (NCBI)