Products 2383800-11-9

CAS 2383800-11-9 is the registry number for 3,5-Difluoro-2-formylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3,5-difluoro-2-formylbenzoic acid (CAS 2383800-11-9) is a chemical compound with the molecular formula C8H4F2O3 and a molecular weight of 186.11 g/mol. IUPAC name: 3,5-difluoro-2-formylbenzoic acid. InChIKey: XSVXGFGTZMDMHC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4F2O3
Molecular weight186.11 g/mol
IUPAC name3,5-difluoro-2-formylbenzoic acid
InChIKeyXSVXGFGTZMDMHC-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)C=O)F)F

Computed by PubChem (NCBI)