CAS 1374150-50-1 appears in our catalog under these names: 4,5-Difluoro-2-formylbenzoic acid 98%, 4,5-Difluoro-2-formylbenzoic acid, 98%, 98%, 4,5-DIFLUORO-2-FORMYLBENZOIC ACID, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4,5-difluoro-2-formylbenzoic acid (CAS 1374150-50-1) is a chemical compound with the molecular formula C8H4F2O3 and a molecular weight of 186.11 g/mol. IUPAC name: 4,5-difluoro-2-formylbenzoic acid. InChIKey: SHWNWLIWWNFNEF-UHFFFAOYSA-N.
| Molecular formula | C8H4F2O3 |
|---|---|
| Molecular weight | 186.11 g/mol |
| IUPAC name | 4,5-difluoro-2-formylbenzoic acid |
| InChIKey | SHWNWLIWWNFNEF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)C(=O)O)C=O |
Computed by PubChem (NCBI)