Products 1242070-98-9

CAS 1242070-98-9 appears in our catalog under these names: 2,6-Difluoro-4-formylbenzoic acid, 98%, 98%, 2,6-Difluoro-4-formylbenzoic acid 98%, 2,6-Difluoro-4-formylbenzoic acid, 98%, 2,6-Difluoro-4-formylbenzoic acid, 97%, 2,6–Difluoro–4–formylbenzoic acid. Offered by: Chemat, Ambeed, Fluorochem, Combi-blocks, GLPBio. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

2,6-difluoro-4-formylbenzoic acid (CAS 1242070-98-9) is a chemical compound with the molecular formula C8H4F2O3 and a molecular weight of 186.11 g/mol. IUPAC name: 2,6-difluoro-4-formylbenzoic acid. InChIKey: KUZZMQQMBLSIOJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4F2O3
Molecular weight186.11 g/mol
IUPAC name2,6-difluoro-4-formylbenzoic acid
InChIKeyKUZZMQQMBLSIOJ-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1F)C(=O)O)F)C=O

Computed by PubChem (NCBI)