CAS 132115-70-9 is the registry number for 2,6-Difluoro-a-oxo-benzeneacetic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(2,6-difluorophenyl)-2-oxoacetic acid (CAS 132115-70-9) is a chemical compound with the molecular formula C8H4F2O3 and a molecular weight of 186.11 g/mol. IUPAC name: 2-(2,6-difluorophenyl)-2-oxoacetic acid. InChIKey: GXVMQUZNRKOOFW-UHFFFAOYSA-N.
| Molecular formula | C8H4F2O3 |
|---|---|
| Molecular weight | 186.11 g/mol |
| IUPAC name | 2-(2,6-difluorophenyl)-2-oxoacetic acid |
| InChIKey | GXVMQUZNRKOOFW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)C(=O)O)F |
Computed by PubChem (NCBI)