Products 2386498-20-8
CAS 2386498-20-8 appears in our catalog under these names: 3,4-Difluoro-5-formylbenzoic acid, 95%, 3,4-Difluoro-5-formylbenzoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg.
3,4-difluoro-5-formylbenzoic acid (CAS 2386498-20-8) is a chemical compound with the molecular formula C8H4F2O3 and a molecular weight of 186.11 g/mol. IUPAC name: 3,4-difluoro-5-formylbenzoic acid. InChIKey: YWKLGWJHGMVZMG-UHFFFAOYSA-N.
| Molecular formula | C8H4F2O3 |
|---|---|
| Molecular weight | 186.11 g/mol |
| IUPAC name | 3,4-difluoro-5-formylbenzoic acid |
| InChIKey | YWKLGWJHGMVZMG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=O)F)F)C(=O)O |
Computed by PubChem (NCBI)