CAS 1162676-00-7 appears in our catalog under these names: Methyl 4–amino–3,5–difluorobenzoate, methyl 4-amino-3,5-difluorobenzoate, Methyl 4-amino-3,5-difluorobenzoate, 95%, 95%, Methyl 4-amino-3,5-difluorobenzoate, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g, 100mg, 5g, 500mg.
Methyl 4-amino-3,5-difluorobenzoate (CAS 1162676-00-7) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: methyl 4-amino-3,5-difluorobenzoate. InChIKey: USVQDPOQLNDARY-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | methyl 4-amino-3,5-difluorobenzoate |
| InChIKey | USVQDPOQLNDARY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)F)N)F |
Computed by PubChem (NCBI)