CAS 116366-31-5 is the registry number for Boc-2-Nitro-DL-phenylalanine, 95%. Offered by: AmBeed. Available pack sizes: 5g, 25g.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-nitrophenyl)propanoic acid (CAS 116366-31-5) is a chemical compound with the molecular formula C14H18N2O6 and a molecular weight of 310.30 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-nitrophenyl)propanoic acid. InChIKey: BSHMNGMAJNWNBP-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O6 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-nitrophenyl)propanoic acid |
| InChIKey | BSHMNGMAJNWNBP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC=CC=C1[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)