Products 1164251-88-0
CAS 1164251-88-0 is the registry number for 7-Chloro-4,6-dimethoxy-2,3-dihydro-1H-indole-2,3-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-chloro-4,6-dimethoxy-1H-indole-2,3-dione (CAS 1164251-88-0) is a chemical compound with the molecular formula C10H8ClNO4 and a molecular weight of 241.63 g/mol. IUPAC name: 7-chloro-4,6-dimethoxy-1H-indole-2,3-dione. InChIKey: XKCUBAAAVCWCBV-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO4 |
|---|---|
| Molecular weight | 241.63 g/mol |
| IUPAC name | 7-chloro-4,6-dimethoxy-1H-indole-2,3-dione |
| InChIKey | XKCUBAAAVCWCBV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C2=C1C(=O)C(=O)N2)Cl)OC |
Computed by PubChem (NCBI)