Products 17124-56-0

CAS 17124-56-0 is the registry number for 3-(6-Chloro-2-oxo-1,3-benzoxazol-3(2h)-yl)propanoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid (CAS 17124-56-0) is a chemical compound with the molecular formula C10H8ClNO4 and a molecular weight of 241.63 g/mol. IUPAC name: 3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid. InChIKey: MFDFGXAEYPOBHG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8ClNO4
Molecular weight241.63 g/mol
IUPAC name3-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid
InChIKeyMFDFGXAEYPOBHG-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1Cl)OC(=O)N2CCC(=O)O

Computed by PubChem (NCBI)