CAS 123040-75-5 appears in our catalog under these names: 6-Chloro-3,4-dihydro-3-oxo-2H-1,4-benzoxazine-8-carboxylic Acid Methyl Ester, 6–Chloro–3,4–dihydro–3–oxo–2H–1,4–benzoxazine–8–carboxylic acid methyl ester, Methyl 6-chloro-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-8-carboxylate, ≥95%, ≥95%. Offered by: TRC, GLPBio, Chemat. Available pack sizes: 1g, 2g, 500mg, 50mg, 250mg.
Methyl 6-chloro-3-oxo-4H-1,4-benzoxazine-8-carboxylate (CAS 123040-75-5) is a chemical compound with the molecular formula C10H8ClNO4 and a molecular weight of 241.63 g/mol. IUPAC name: methyl 6-chloro-3-oxo-4H-1,4-benzoxazine-8-carboxylate. InChIKey: GDSWKMQEDQRHLC-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO4 |
|---|---|
| Molecular weight | 241.63 g/mol |
| IUPAC name | methyl 6-chloro-3-oxo-4H-1,4-benzoxazine-8-carboxylate |
| InChIKey | GDSWKMQEDQRHLC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC(=C1)Cl)NC(=O)CO2 |
Computed by PubChem (NCBI)