CAS 876660-88-7 is the registry number for 2-(6-Chloro-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
2-(6-chloro-3-oxo-4H-1,4-benzoxazin-2-yl)acetic acid (CAS 876660-88-7) is a chemical compound with the molecular formula C10H8ClNO4 and a molecular weight of 241.63 g/mol. IUPAC name: 2-(6-chloro-3-oxo-4H-1,4-benzoxazin-2-yl)acetic acid. InChIKey: MOZBBVBSBDWULD-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO4 |
|---|---|
| Molecular weight | 241.63 g/mol |
| IUPAC name | 2-(6-chloro-3-oxo-4H-1,4-benzoxazin-2-yl)acetic acid |
| InChIKey | MOZBBVBSBDWULD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC(=O)C(O2)CC(=O)O |
Computed by PubChem (NCBI)