CAS 41405-50-9 appears in our catalog under these names: 3-(5-Chloro-2-oxo-1,3-benzoxazol-3(2h)-yl)propanoic acid, 95%, 3-(5-Chloro-2-oxobenzo(d)oxazol-3(2H)-yl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
3-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid (CAS 41405-50-9) is a chemical compound with the molecular formula C10H8ClNO4 and a molecular weight of 241.63 g/mol. IUPAC name: 3-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid. InChIKey: ODWSXTKSQNMMMQ-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO4 |
|---|---|
| Molecular weight | 241.63 g/mol |
| IUPAC name | 3-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)propanoic acid |
| InChIKey | ODWSXTKSQNMMMQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N(C(=O)O2)CCC(=O)O |
Computed by PubChem (NCBI)